AB77875
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | in stock | $13.00 | $9.00 | - + | |
100mg | 98% | in stock | $23.00 | $16.00 | - + | |
250mg | 98% | in stock | $39.00 | $27.00 | - + | |
1g | 98% | in stock | $55.00 | $38.00 | - + | |
5g | 98% | in stock | $88.00 | $61.00 | - + | |
25g | 98% | in stock | $429.00 | $300.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77875 |
Chemical Name: | Fmoc-lys(biotin)-oh |
CAS Number: | 146987-10-2 |
Molecular Formula: | C31H38N4O6S |
Molecular Weight: | 594.7216200000003 |
MDL Number: | MFCD00270741 |
SMILES: | O=C(NCCCC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2 |
Complexity: | 946 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 42 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 15 |
XLogP3: | 3.6 |
Fmoc-Lys(Biotin)-OH is a versatile compound commonly used in chemical synthesis for the conjugation of biotin molecules to peptides or proteins. This allows for specific and efficient labeling of target molecules, making Fmoc-Lys(Biotin)-OH a valuable tool in research and development. Additionally, the Fmoc protecting group can be easily removed under mild conditions, enabling further modification of the synthesized molecules. Its application extends to the fields of bioconjugation, proteomics, and drug discovery, making it an essential reagent for researchers looking to enhance the specificity and sensitivity of their assays.