AA65411
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $41.00 | $29.00 | - + | |
1g | 95% | in stock | $45.00 | $32.00 | - + | |
5g | 95% | in stock | $178.00 | $125.00 | - + | |
10g | 95% | in stock | $324.00 | $227.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA65411 |
Chemical Name: | (S)-(((1-(6-Amino-9h-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic acid |
CAS Number: | 147127-19-3 |
Molecular Formula: | C9H14N5O4P |
Molecular Weight: | 287.2123 |
MDL Number: | MFCD21604708 |
SMILES: | C[C@@H](Cn1cnc2c1ncnc2N)OCP(=O)(O)O |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | -1.6 |
Retrovirology 20120101
Biochemical and biophysical research communications 19960215
Antimicrobial agents and chemotherapy 19930201