AB42802
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $5.00 | - + | |
5g | 97% | in stock | $17.00 | $12.00 | - + | |
10g | 97% | in stock | $33.00 | $23.00 | - + | |
25g | 97% | in stock | $80.00 | $56.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42802 |
Chemical Name: | N-Boc-trans-4-hydroxy-D-proline |
CAS Number: | 147266-92-0 |
Molecular Formula: | C10H17NO5 |
Molecular Weight: | 231.2457 |
MDL Number: | MFCD01861341 |
SMILES: | O[C@@H]1CN([C@H](C1)C(=O)O)C(=O)OC(C)(C)C |
Complexity: | 296 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.3 |
The compound (2R,4S)-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid, also known as $name$, is commonly utilized in chemical synthesis as a key building block for the creation of various pharmaceuticals and organic molecules. Its distinct chiral structure confers specific stereochemistry to the molecules it is incorporated into, making it a crucial component in asymmetric synthesis strategies. By leveraging the unique properties of this compound, chemists can efficiently construct complex molecular structures with high levels of selectivity and efficiency. In addition to its role in pharmaceutical development, (2R,4S)-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid is also employed in the creation of specialized materials and research applications requiring precise stereochemical control.