AA66584
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $23.00 | $16.00 | - + | |
5g | 95% | in stock | $50.00 | $35.00 | - + | |
25g | 95% | in stock | $122.00 | $86.00 | - + | |
100g | 95% | in stock | $449.00 | $315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA66584 |
Chemical Name: | Dibenzyl diselenide |
CAS Number: | 1482-82-2 |
Molecular Formula: | C14H14Se2 |
Molecular Weight: | 340.18096 |
MDL Number: | MFCD00004767 |
SMILES: | [Se](Cc1ccccc1)[Se]Cc1ccccc1 |
Complexity: | 150 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Rotatable Bond Count: | 5 |
European journal of medicinal chemistry 20110801
Langmuir : the ACS journal of surfaces and colloids 20060620