AA73765
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $226.00 | $159.00 | - + | |
1g | 98% | in stock | $687.00 | $481.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA73765 |
Chemical Name: | Benzenamine, 4-(2,4-dichlorophenoxy)- |
CAS Number: | 14861-17-7 |
Molecular Formula: | C12H9Cl2NO |
Molecular Weight: | 254.112 |
MDL Number: | MFCD00459612 |
SMILES: | Nc1ccc(cc1)Oc1ccc(cc1Cl)Cl |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.8 |
Journal of agricultural and food chemistry 20081008
Die Pharmazie 20030901