AA74915
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $43.00 | $30.00 | - + | |
5mg | 97% | in stock | $54.00 | $38.00 | - + | |
100mg | 97% | in stock | $291.00 | $204.00 | - + | |
250mg | 97% | in stock | $496.00 | $347.00 | - + | |
1g | 97% | in stock | $1,303.00 | $912.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA74915 |
Chemical Name: | (2R,4S)-5-([1,1'-Biphenyl]-4-yl)-4-(3-carboxypropanamido)-2-methylpentanoic acid |
CAS Number: | 149709-44-4 |
Molecular Formula: | C22H25NO5 |
Molecular Weight: | 383.4376 |
MDL Number: | MFCD00921225 |
SMILES: | C[C@@H](C(=O)O)C[C@@H](Cc1ccc(cc1)c1ccccc1)NC(=O)CCC(=O)O |
Complexity: | 521 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 10 |
XLogP3: | 3 |
Journal of clinical pharmacology 20100401