AA76585
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | in stock | $22.00 | $15.00 | - + | |
5g | 98% | in stock | $30.00 | $21.00 | - + | |
10g | 98% | in stock | $48.00 | $34.00 | - + | |
25g | 98% | in stock | $119.00 | $84.00 | - + | |
100g | ≥ 99% (HPLC) | in stock | $352.00 | $247.00 | - + | |
250g | ≥ 99% (HPLC) | in stock | $749.00 | $524.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA76585 |
Chemical Name: | 3-Hydroxy-6-methyl-2-nitropyridine |
CAS Number: | 15128-90-2 |
Molecular Formula: | C6H6N2O3 |
Molecular Weight: | 154.1234 |
MDL Number: | MFCD00006259 |
SMILES: | Cc1ccc(c(n1)[N+](=O)[O-])O |
NSC Number: | 102501 |
Complexity: | 156 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.6 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20121001