AI66374
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 97% | 2 weeks | $400.00 | $280.00 | - + | |
100mg | 97% | 2 weeks | $702.00 | $491.00 | - + | |
250mg | 97% | 2 weeks | $1,187.00 | $831.00 | - + | |
1g | 97% | 2 weeks | $2,789.00 | $1,952.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI66374 |
Chemical Name: | trans-3-(Benzylamino)cyclobutanecarboxylic acid compound with 2,2,2-trifluoroacetic acid (1:1) |
CAS Number: | 1523617-97-1 |
Molecular Formula: | C14H16F3NO4 |
Molecular Weight: | 319.2763 |
MDL Number: | MFCD27956888 |
SMILES: | OC(=O)C(F)(F)F.OC(=O)[C@@H]1C[C@H](C1)NCc1ccccc1 |