AB45096
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $18.00 | $12.00 | - + | |
10g | 98% | in stock | $22.00 | $15.00 | - + | |
25g | 98% | in stock | $26.00 | $18.00 | - + | |
100g | 98% | in stock | $89.00 | $62.00 | - + | |
500g | 98% | in stock | $225.00 | $157.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45096 |
Chemical Name: | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine |
CAS Number: | 152460-10-1 |
Molecular Formula: | C16H15N5 |
Molecular Weight: | 277.3238 |
MDL Number: | MFCD09028125 |
SMILES: | Nc1ccc(c(c1)Nc1nccc(n1)c1cccnc1)C |
Complexity: | 324 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.4 |
Journal of separation science 20120801