AI37202
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $26.00 | $18.00 | - + | |
25g | 97% | in stock | $42.00 | $30.00 | - + | |
100g | 97% | in stock | $90.00 | $63.00 | - + | |
500g | 97% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI37202 |
Chemical Name: | (+)-Menthol |
CAS Number: | 15356-60-2 |
Molecular Formula: | C10H20O |
Molecular Weight: | 156.2652 |
MDL Number: | MFCD00062983 |
SMILES: | C[C@H]1CC[C@@H]([C@H](C1)O)C(C)C |
Complexity: | 120 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
British journal of pharmacology 20040201