AF00306
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $14.00 | $10.00 | - + | |
1g | 97% | in stock | $15.00 | $11.00 | - + | |
5g | 97% | in stock | $38.00 | $27.00 | - + | |
25g | 97% | in stock | $145.00 | $102.00 | - + | |
100g | 97% | in stock | $362.00 | $254.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF00306 |
Chemical Name: | (2,6,6-Trimethyl-2-hydroxycyclohexylidene)acetic acid lactone |
CAS Number: | 15356-74-8 |
Molecular Formula: | C11H16O2 |
Molecular Weight: | 180.2435 |
MDL Number: | MFCD06409986 |
SMILES: | O=C1C=C2C(O1)(C)CCCC2(C)C |
NSC Number: | 357087 |
Complexity: | 289 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 2.2 |
Natural product research 20120101
Huan jing ke xue= Huanjing kexue 20080801
Journal of agricultural and food chemistry 20021023