AB66483
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $38.00 | $26.00 | - + | |
25g | 95% | in stock | $106.00 | $75.00 | - + | |
100g | 95% | in stock | $372.00 | $260.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66483 |
Chemical Name: | 4-Acetamido-3-nitrobenzoic acid |
CAS Number: | 1539-06-6 |
Molecular Formula: | C9H8N2O5 |
Molecular Weight: | 224.1702 |
MDL Number: | MFCD00014703 |
SMILES: | CC(=O)Nc1ccc(cc1[N+](=O)[O-])C(=O)O |
NSC Number: | 190738 |
Complexity: | 312 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.7 |
Journal of medicinal chemistry 19971205
Journal of medicinal chemistry 19950818