logo
Home  > Chemistry  > Synthetic Reagents  > Synthetic Reagent Others  > 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium chloride

AE92408

154-87-0 | 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium chloride

Packsize Purity Availability Price Discounted Price    Quantity
500mg 95% in stock $33.00 $23.00 -   +
1g 95% in stock $49.00 $35.00 -   +
5g 95% in stock $126.00 $88.00 -   +
25g 95% in stock $432.00 $303.00 -   +
100g 95% in stock $1,126.00 $788.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE92408
Chemical Name: 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium chloride
CAS Number: 154-87-0
Molecular Formula: C12H19ClN4O7P2S
Molecular Weight: 460.76738200000005
MDL Number: MFCD00038740
SMILES: Cc1ncc(c(n1)N)C[n+]1csc(c1C)CCOP(=O)(OP(=O)(O)O)O.[Cl-]

 

Computed Properties
Complexity: 568  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 27  
Hydrogen Bond Acceptor Count: 12  
Hydrogen Bond Donor Count: 4  
Rotatable Bond Count: 8  

 

 

Upstream Synthesis Route 
  • The Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-4-methyl-5-(4,6,6-trihydroxy-4,6-dioxido-3,5-dioxa-4,6-diphosphahex-1-yl)-, chloride (1:1) compound plays a crucial role in chemical synthesis processes. Leveraging its unique chemical properties, this compound is adept at facilitating a wide range of synthetic reactions. Specifically, it serves as a potent catalyst in various transformations and is instrumental in the formation of complex molecular structures. Its versatility allows for the efficient and precise construction of intricate chemical frameworks, making it a valuable tool for researchers and chemists alike in the development of novel compounds and materials.
Literature
FEATURED PRODUCTS