AD48206
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $201.00 | $141.00 | - + | |
5g | 97% | in stock | $572.00 | $400.00 | - + | |
10g | 97% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD48206 |
Chemical Name: | 5-[(4-Hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
CAS Number: | 154052-92-3 |
Molecular Formula: | C10H7NO3S |
Molecular Weight: | 221.2325 |
MDL Number: | MFCD00711076 |
SMILES: | O=C1NC(=O)SC1=Cc1ccc(cc1)O |
Complexity: | 319 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
Undefined Bond Stereocenter Count: | 1 |
XLogP3: | 1.8 |
European journal of medicinal chemistry 20120301