AA77633
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $28.00 | $20.00 | - + | |
1g | 98% | in stock | $70.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA77633 |
Chemical Name: | 4-(((2-Ethylhexyl)oxy)carbonyl)benzoic acid |
CAS Number: | 155603-50-2 |
Molecular Formula: | C16H21O4 |
Molecular Weight: | 277.3355 |
MDL Number: | MFCD02752454 |
SMILES: | CCCCC(COC(=O)c1ccc(cc1)C(=O)[O-])CC |
Complexity: | 306 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.4 |
Zhong yao cai = Zhongyaocai = Journal of Chinese medicinal materials 20100301