logo
Home  > Chemistry  > Catalysis Chemistry  > Metal Catalysts  > [1,3-Bis(diphenylphosphino)propane]nickel(ii) chloride

AB43008

15629-92-2 | [1,3-Bis(diphenylphosphino)propane]nickel(ii) chloride

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $16.00 $11.00 -   +
25g 95% in stock $19.00 $13.00 -   +
100g 95% in stock $31.00 $22.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB43008
Chemical Name: [1,3-Bis(diphenylphosphino)propane]nickel(ii) chloride
CAS Number: 15629-92-2
Molecular Formula: C27H26Cl2NiP2
Molecular Weight: 542.0423
MDL Number: MFCD00015318
SMILES: C(CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.Cl[Ni]Cl

 

Computed Properties
Complexity: 353  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 32  
Rotatable Bond Count: 8  

 

 

Upstream Synthesis Route
  • 1,3-Bis(diphenylphosphino)propane nickel(II) chloride, also known as Ni(dppp)Cl2, is a versatile catalyst used in various chemical synthesis reactions. This coordination complex plays a crucial role in catalyzing organic transformations due to its ability to facilitate a wide range of reactions with high efficiency and selectivity.In chemical synthesis, 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is commonly employed in cross-coupling reactions such as the Heck reaction, Suzuki reaction, and Stille reaction. These reactions involve the coupling of organic substrates to form new carbon-carbon or carbon-heteroatom bonds, and the presence of the Ni(dppp)Cl2 catalyst significantly accelerates these processes.Furthermore, this nickel complex is used in hydrogenation reactions to reduce the unsaturation of organic compounds, leading to the formation of saturated products. Its ability to catalyze both homogenous and heterogenous hydrogenation reactions makes it highly useful in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals.Overall, 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is an indispensable tool in modern organic synthesis, enabling chemists to access complex molecular structures with enhanced efficiency and precision.
FEATURED PRODUCTS