AA78887
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $33.00 | $23.00 | - + | |
100mg | 95% | in stock | $100.00 | $70.00 | - + | |
250mg | 95% | in stock | $208.00 | $145.00 | - + | |
1g | 95% | in stock | $516.00 | $361.00 | - + | |
5g | 95% | in stock | $2,314.00 | $1,620.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA78887 |
Chemical Name: | Benzene, 1,1'-(1-methylethylidene)bis[4-methoxy- |
CAS Number: | 1568-83-8 |
Molecular Formula: | C17H20O2 |
Molecular Weight: | 256.3395 |
MDL Number: | MFCD00984727 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(C)C |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 4 |
Journal of agricultural and food chemistry 20040728
The Journal of pharmacology and experimental therapeutics 20010201