AA81527
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $29.00 | $21.00 | - + | |
1g | 98% | in stock | $35.00 | $25.00 | - + | |
5g | 98% | in stock | $140.00 | $98.00 | - + | |
10g | 98% | in stock | $264.00 | $185.00 | - + | |
25g | 98% | in stock | $528.00 | $370.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA81527 |
Chemical Name: | tert-Butyl 6-hydroxy-3,4-dihydroisoquinoline-2(1H)-carboxylate |
CAS Number: | 158984-83-9 |
Molecular Formula: | C14H19NO3 |
Molecular Weight: | 249.3056 |
MDL Number: | MFCD08275034 |
SMILES: | Oc1ccc2c(c1)CCN(C2)C(=O)OC(C)(C)C |
Complexity: | 311 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
Journal of medicinal chemistry 20110414