AA81077
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $33.00 | $23.00 | - + | |
25g | 95% | in stock | $73.00 | $51.00 | - + | |
100g | 95% | in stock | $201.00 | $141.00 | - + | |
500g | 95% | in stock | $778.00 | $545.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA81077 |
Chemical Name: | 2,4,5-Trichlorobenzenesulfonyl chloride |
CAS Number: | 15945-07-0 |
Molecular Formula: | C6H2Cl4O2S |
Molecular Weight: | 279.9559 |
MDL Number: | MFCD00007428 |
SMILES: | Clc1cc(c(cc1Cl)Cl)S(=O)(=O)Cl |
NSC Number: | 26958 |
Complexity: | 273 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.8 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20121101