AW47093
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $390.00 | $273.00 | - + | |
100mg | 95% | 1 week | $557.00 | $390.00 | - + | |
250mg | 95% | 1 week | $774.00 | $542.00 | - + | |
500mg | 95% | 1 week | $1,190.00 | $833.00 | - + | |
1g | 95% | 1 week | $1,511.00 | $1,058.00 | - + | |
2.5g | 95% | 1 week | $2,912.00 | $2,039.00 | - + | |
5g | 95% | 1 week | $4,285.00 | $3,000.00 | - + | |
10g | 95% | 1 week | $6,330.00 | $4,431.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW47093 |
Chemical Name: | tert-butyl N-[(3-methylpiperidin-4-yl)methyl]carbamate, Mixture of diastereomers |
CAS Number: | 1602995-90-3 |
Molecular Formula: | C12H24N2O2 |
Molecular Weight: | 228.3312 |
MDL Number: | MFCD28613743 |
SMILES: | O=C(OC(C)(C)C)NCC1CCNCC1C |