logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Epoxides  > tert-Butyl 7-oxa-3-aza-bicyclo[4.1.0]heptane-3-carboxylate

AA83008

161157-50-2 | tert-Butyl 7-oxa-3-aza-bicyclo[4.1.0]heptane-3-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $8.00 $5.00 -   +
5g 95% in stock $9.00 $7.00 -   +
10g 95% in stock $17.00 $12.00 -   +
25g 95% in stock $34.00 $24.00 -   +
100g 95% in stock $108.00 $76.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA83008
Chemical Name: tert-Butyl 7-oxa-3-aza-bicyclo[4.1.0]heptane-3-carboxylate
CAS Number: 161157-50-2
Molecular Formula: C10H17NO3
Molecular Weight: 199.2469
MDL Number: MFCD12407050
SMILES: O=C(N1CCC2C(C1)O2)OC(C)(C)C

 

Computed Properties
Complexity: 246  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 2  
Undefined Atom Stereocenter Count: 2  
XLogP3: 1  

 

 

Upstream Synthesis Route
  • The tert-Butyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate is a versatile compound widely used in chemical synthesis due to its unique structural characteristics. This compound serves as a valuable building block in the production of various organic molecules, particularly in the pharmaceutical and agrochemical industries. In chemical synthesis, tert-Butyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate can be employed as a key intermediate for the synthesis of bioactive compounds and pharmaceutical agents. Its cyclic structure and functional groups make it a valuable precursor for creating complex molecular structures with specific properties.Additionally, this compound can be utilized in the development of new materials with tailored chemical and physical properties. Its ability to undergo various chemical reactions allows for the introduction of different functional groups, enabling the synthesis of diverse molecules with desired characteristics.Overall, tert-Butyl 7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate plays a crucial role in advancing chemical synthesis by facilitating the construction of intricate organic molecules and enabling the discovery of novel compounds with potential applications in various industries.
FEATURED PRODUCTS