AA83502
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $42.00 | $29.00 | - + | |
5mg | 97% | in stock | $141.00 | $99.00 | - + | |
10mg | 97% | in stock | $197.00 | $138.00 | - + | |
25mg | 97% | in stock | $442.00 | $310.00 | - + | |
100mg | 97% | in stock | $565.00 | $395.00 | - + | |
250mg | 97% | in stock | $1,090.00 | $763.00 | - + | |
1g | 97% | in stock | $2,672.00 | $1,870.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA83502 |
Chemical Name: | GSK2801 |
CAS Number: | 1619994-68-1 |
Molecular Formula: | C20H21NO4S |
Molecular Weight: | 371.4500399999999 |
MDL Number: | MFCD26142953 |
SMILES: | CCCOc1ccn2c(c1)c(cc2C(=O)C)c1ccccc1S(=O)(=O)C |
Complexity: | 599 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.2 |
The EMBO journal 20100707
Genomics 20000101