AF03717
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $57.00 | $40.00 | - + | |
5mg | 98% | in stock | $83.00 | $58.00 | - + | |
10mg | 98% | in stock | $107.00 | $75.00 | - + | |
25mg | 98% | in stock | $138.00 | $97.00 | - + | |
50mg | 98% | in stock | $180.00 | $126.00 | - + | |
100mg | 98% | in stock | $303.00 | $212.00 | - + | |
250mg | 98% | in stock | $576.00 | $403.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF03717 |
Chemical Name: | RAF709 |
CAS Number: | 1628838-42-5 |
Molecular Formula: | C28H29F3N4O4 |
Molecular Weight: | 542.5494696 |
MDL Number: | MFCD30534393 |
SMILES: | Cc1ncc(cc1c1cnc(c(c1)N1CCOCC1)OC1CCOCC1)NC(=O)c1cccc(c1)C(F)(F)F |
Complexity: | 793 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 39 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 4 |
Journal of the Chemical Society. Perkin transactions 1 19750101