logo
Home  > N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline

AA85650

16357-59-8 | N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline

Packsize Purity Availability Price Discounted Price    Quantity
10g 98% in stock $8.00 $5.00 -   +
25g 98% in stock $12.00 $8.00 -   +
100g 98% in stock $35.00 $24.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA85650
Chemical Name: N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline
CAS Number: 16357-59-8
Molecular Formula: C14H17NO3
Molecular Weight: 247.2897
MDL Number: MFCD00006703
SMILES: CCOC(=O)N1C(OCC)C=Cc2c1cccc2
NSC Number: 147831

 

Computed Properties
Complexity: 316  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 4  
Undefined Atom Stereocenter Count: 1  
XLogP3: 2.8  

 

 

Upstream Synthesis Route 
  • Ethyl 1,2-dihydro-2-ethoxy-1-quinolinecarboxylate, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound serves as a valuable starting material in the synthesis of various heterocyclic compounds due to its unique structural features. Its functional groups enable it to participate in a wide range of chemical reactions, leading to the formation of complex organic molecules with diverse applications.In chemical synthesis, $name$ can be employed as a key intermediate for the preparation of biologically active compounds, pharmaceuticals, agrochemicals, and materials with specialized properties. Its reactivity allows for the introduction of substituents at specific positions within the quinoline ring, leading to the generation of novel molecules with tailored functionalities. Moreover, the ethoxy and ethyl groups in the molecule can be manipulated to modulate the compound's solubility, stability, and biological activity, making it highly valuable in medicinal and chemical research.Researchers and chemists utilize Ethyl 1,2-dihydro-2-ethoxy-1-quinolinecarboxylate as a strategic precursor to access a diverse range of structurally complex compounds with potential applications in drug discovery, material science, and molecular engineering. Its role in chemical synthesis extends beyond mere building block usage, as it serves as a versatile scaffold for the design and construction of intricate molecular architectures with desired properties.
Literature
FEATURED PRODUCTS