AA86649
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $25.00 | $18.00 | - + | |
10mg | 98% | in stock | $30.00 | $21.00 | - + | |
25mg | 98% | in stock | $34.00 | $24.00 | - + | |
50mg | 98% | in stock | $44.00 | $31.00 | - + | |
100mg | 98% | in stock | $54.00 | $38.00 | - + | |
1g | 98% | in stock | $209.00 | $147.00 | - + | |
5g | 98% | in stock | $630.00 | $441.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA86649 |
Chemical Name: | (2R,3R)-2-(2,4-Difluorophenyl)-3-(4-methylenepiperidin-1-yl)-1-(1h-1,2,4-triazol-1-yl)butan-2-ol |
CAS Number: | 164650-44-6 |
Molecular Formula: | C18H22F2N4O |
Molecular Weight: | 348.3903 |
MDL Number: | MFCD00936406 |
SMILES: | C=C1CCN(CC1)[C@@H]([C@@](c1ccc(cc1F)F)(Cn1cncn1)O)C |
Complexity: | 470 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2 |
Drugs 20131101
Antimicrobial agents and chemotherapy 20130501
Microbiology and immunology 20020101