AA88843
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $82.00 | $58.00 | - + | |
1g | 95% | in stock | $89.00 | $62.00 | - + | |
5g | 95% | in stock | $295.00 | $207.00 | - + | |
25g | 95% | in stock | $1,263.00 | $884.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA88843 |
Chemical Name: | (9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate |
CAS Number: | 166410-32-8 |
Molecular Formula: | C17H18N2O2 |
Molecular Weight: | 282.337 |
MDL Number: | MFCD01318872 |
SMILES: | NCCNC(=O)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 339 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
The (9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate is a versatile compound commonly employed in chemical synthesis for its unique properties. Acting as a bifunctional molecule, it serves as a valuable building block in the creation of various organic compounds. Specifically, its aminoethyl group allows for selective derivatization and functionalization, while the fluorenyl group provides stability and rigidity to the molecular structure. In chemical synthesis, this compound is utilized in the formation of complex molecules, such as pharmaceuticals, agrochemicals, and materials, where precise control over molecular architecture is crucial. By incorporating (9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate into synthetic routes, chemists can access novel compounds with enhanced properties and functionalities, making it an indispensable tool in modern organic chemistry.