AA88882
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 95% | in stock | $12.00 | $8.00 | - + | |
25g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $44.00 | $31.00 | - + | |
500g | 98% | in stock | $218.00 | $153.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA88882 |
Chemical Name: | 3-(4-Nitrophenyl)propanoic acid |
CAS Number: | 16642-79-8 |
Molecular Formula: | C9H9NO4 |
Molecular Weight: | 195.1721 |
MDL Number: | MFCD00126834 |
SMILES: | OC(=O)CCc1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 99345 |
Complexity: | 215 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.3 |
Biodegradation 20120701
Journal of medicinal chemistry 20110512