AA88881
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $25.00 | $17.00 | - + | |
500g | 98% | in stock | $473.00 | $331.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA88881 |
Chemical Name: | 4-(Trifluoromethyl)cinnamic acid |
CAS Number: | 16642-92-5 |
Molecular Formula: | C10H7F3O2 |
Molecular Weight: | 216.15658960000005 |
MDL Number: | MFCD00002696 |
SMILES: | OC(=O)/C=C/c1ccc(cc1)C(F)(F)F |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3 |
European journal of medicinal chemistry 20120101