AA89609
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $11.00 | - + | |
1g | 95% | in stock | $23.00 | $17.00 | - + | |
5g | 95% | in stock | $87.00 | $61.00 | - + | |
25g | 95% | in stock | $431.00 | $302.00 | - + | |
100g | 95% | in stock | $1,506.00 | $1,054.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89609 |
Chemical Name: | 6-Methoxyindole-2-carboxylic acid |
CAS Number: | 16732-73-3 |
Molecular Formula: | C10H9NO3 |
Molecular Weight: | 191.18336 |
MDL Number: | MFCD01548823 |
SMILES: | COc1ccc2c(c1)[nH]c(c2)C(=O)O |
NSC Number: | 27988 |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
1H-Indole-2-carboxylic acid, 6-methoxy- is a versatile compound widely used in chemical synthesis as an important building block. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity make it valuable for introducing specific functional groups and substituents in organic synthesis. In pharmaceutical research and development, 1H-Indole-2-carboxylic acid, 6-methoxy- is utilized for the preparation of novel drug candidates due to its ability to modulate biological activity and pharmacological properties. Furthermore, in agrochemical applications, this compound plays a crucial role in the synthesis of pesticides and herbicides with enhanced efficacy and environmental safety profiles. Its utility extends to the synthesis of specialty chemicals and materials, providing opportunities for creating new compounds with tailored properties for various industrial applications.