AA89813
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $22.00 | $16.00 | - + | |
250mg | 95% | in stock | $46.00 | $33.00 | - + | |
1g | 95% | in stock | $134.00 | $94.00 | - + | |
5g | 95% | in stock | $667.00 | $467.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89813 |
Chemical Name: | (2R,3R,4S,5R)-2-(4-Chloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol |
CAS Number: | 16754-80-6 |
Molecular Formula: | C11H12ClN3O4 |
Molecular Weight: | 285.6837 |
MDL Number: | MFCD03425528 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1ccc2c1ncnc2Cl |
Complexity: | 337 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
Journal of medicinal chemistry 19821101