AF00764
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $153.00 | $107.00 | - + | |
1g | 98% | in stock | $339.00 | $237.00 | - + | |
5g | 98% | in stock | $1,014.00 | $710.00 | - + | |
10g | 98% | in stock | $1,870.00 | $1,309.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF00764 |
Chemical Name: | 4-(Phenylcarbamoyl)benzoic acid |
CAS Number: | 16777-78-9 |
Molecular Formula: | C14H11NO3 |
Molecular Weight: | 241.242 |
MDL Number: | MFCD04329722 |
SMILES: | O=C(c1ccc(cc1)C(=O)O)Nc1ccccc1 |
Complexity: | 302 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 19881101