AB59422
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $18.00 | - + | |
5g | 98% | in stock | $29.00 | $20.00 | - + | |
25g | 98% | in stock | $86.00 | $60.00 | - + | |
100g | 98% | in stock | $265.00 | $185.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB59422 |
Chemical Name: | 2-(Trifluoromethyl)thioxanthen-9-one |
CAS Number: | 1693-28-3 |
Molecular Formula: | C14H7F3OS |
Molecular Weight: | 280.265 |
MDL Number: | MFCD00079785 |
SMILES: | O=c1c2cc(ccc2sc2c1cccc2)C(F)(F)F |
Complexity: | 368 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 4.9 |
The Journal of biological chemistry 20080404