AB78266
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $9.00 | $6.00 | - + | |
25g | 97% | in stock | $22.00 | $15.00 | - + | |
100g | 97% | in stock | $85.00 | $59.00 | - + | |
500g | 97% | in stock | $249.00 | $175.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB78266 |
Chemical Name: | Phenyl tribromomethyl sulfone |
CAS Number: | 17025-47-7 |
Molecular Formula: | C7H5Br3O2S |
Molecular Weight: | 392.8904 |
MDL Number: | MFCD00060068 |
SMILES: | BrC(S(=O)(=O)c1ccccc1)(Br)Br |
Complexity: | 256 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.9 |
Beilstein journal of organic chemistry 20120101