AB46643
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $5.00 | - + | |
10g | 98% | in stock | $8.00 | $6.00 | - + | |
25g | 98% | in stock | $14.00 | $10.00 | - + | |
50g | 98% | in stock | $22.00 | $16.00 | - + | |
100g | 98% | in stock | $36.00 | $26.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46643 |
Chemical Name: | Bis-(4-methoxybenzyl)amine |
CAS Number: | 17061-62-0 |
Molecular Formula: | C16H19NO2 |
Molecular Weight: | 257.3276 |
MDL Number: | MFCD00277836 |
SMILES: | COc1ccc(cc1)CNCc1ccc(cc1)OC |
Complexity: | 207 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.7 |
Chemistry (Weinheim an der Bergstrasse, Germany) 20121105
The journal of physical chemistry. A 20110804
Inorganic chemistry 20110801
Chemical communications (Cambridge, England) 20100328
Chemistry (Weinheim an der Bergstrasse, Germany) 20030905