AE83060
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $15.00 | $10.00 | - + | |
250mg | 97% | in stock | $19.00 | $13.00 | - + | |
1g | 97% | in stock | $27.00 | $19.00 | - + | |
100g | 97% | in stock | $2,344.00 | $1,641.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE83060 |
Chemical Name: | 4-N-Boc-amino-4-carboxytetrahydropyran |
CAS Number: | 172843-97-9 |
Molecular Formula: | C11H19NO5 |
Molecular Weight: | 245.2723 |
MDL Number: | MFCD02683136 |
SMILES: | O=C(NC1(CCOCC1)C(=O)O)OC(C)(C)C |
Complexity: | 302 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.7 |
Tetrahydro-2H-Pyran-4-Carboxylic Acid is a valuable compound widely utilized in chemical synthesis for its versatile applications. Primarily, it serves as a key building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Chemists frequently employ Tetrahydro-2H-Pyran-4-Carboxylic Acid as a starting material or intermediate in organic synthesis reactions to create complex molecules with specific properties. Its unique structure and reactivity make it an essential component in the creation of novel compounds with potential applications in drug discovery, materials science, and other fields of research.