AB76003
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $5.00 | - + | |
5g | 97% | in stock | $11.00 | $8.00 | - + | |
10g | 97% | in stock | $19.00 | $14.00 | - + | |
25g | 97% | in stock | $48.00 | $33.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB76003 |
Chemical Name: | Methyl 6-hydroxy-2-naphthoate |
CAS Number: | 17295-11-3 |
Molecular Formula: | C12H10O3 |
Molecular Weight: | 202.206 |
MDL Number: | MFCD00100526 |
SMILES: | COC(=O)c1ccc2c(c1)ccc(c2)O |
NSC Number: | 689401 |
Complexity: | 239 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.7 |
Journal of medicinal chemistry 19970411