AA91799
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $32.00 | $22.00 | - + | |
250mg | 98% | in stock | $58.00 | $40.00 | - + | |
1g | 98% | in stock | $103.00 | $72.00 | - + | |
5g | 98% | in stock | $434.00 | $304.00 | - + | |
25g | 98% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA91799 |
Chemical Name: | Alpha-Methyl-D-phenylalanine |
CAS Number: | 17350-84-4 |
Molecular Formula: | C10H13NO2 |
Molecular Weight: | 179.2157 |
MDL Number: | MFCD00153491 |
SMILES: | OC(=O)[C@@](Cc1ccccc1)(N)C |
Complexity: | 187 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.2 |
Amino acids 20090901
Bioscience, biotechnology, and biochemistry 20050501