AA94334
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $53.00 | $37.00 | - + | |
25g | 98% | in stock | $157.00 | $110.00 | - + | |
100g | 98% | in stock | $542.00 | $379.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA94334 |
Chemical Name: | 1,3-Diacetylindole |
CAS Number: | 17537-64-3 |
Molecular Formula: | C12H11NO2 |
Molecular Weight: | 201.2212 |
MDL Number: | MFCD00039692 |
SMILES: | CC(=O)c1cn(c2c1cccc2)C(=O)C |
Complexity: | 287 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.8 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20091201