AA99597
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $23.00 | $16.00 | - + | |
5g | 97% | in stock | $34.00 | $24.00 | - + | |
25g | 97% | in stock | $99.00 | $69.00 | - + | |
500g | 97% | in stock | $1,526.00 | $1,068.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA99597 |
Chemical Name: | Phenyl 4-hydroxybenzoate |
CAS Number: | 17696-62-7 |
Molecular Formula: | C13H10O3 |
Molecular Weight: | 214.2167 |
MDL Number: | MFCD00016467 |
SMILES: | Oc1ccc(cc1)C(=O)Oc1ccccc1 |
Complexity: | 225 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.2 |
International journal of systematic and evolutionary microbiology 20050101