AB00159
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $18.00 | $12.00 | - + | |
5g | 98% | in stock | $18.00 | $13.00 | - + | |
10g | 98% | in stock | $36.00 | $26.00 | - + | |
25g | 98% | in stock | $89.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB00159 |
Chemical Name: | Phenyl Trifluoromethanesulfonate |
CAS Number: | 17763-67-6 |
Molecular Formula: | C7H5F3O3S |
Molecular Weight: | 226.173 |
MDL Number: | MFCD00192399 |
SMILES: | FC(S(=O)(=O)Oc1ccccc1)(F)F |
Complexity: | 272 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.5 |
The Journal of organic chemistry 20070914
Journal of the American Chemical Society 20040204
Inorganic chemistry 20030127