AB00257
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $106.00 | $75.00 | - + | |
5g | 97% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB00257 |
Chemical Name: | 3',5'-Bis(trifluoromethyl)biphenyl-3-carboxylic acid |
CAS Number: | 177733-57-2 |
Molecular Formula: | C15H8F6O2 |
Molecular Weight: | 334.2132 |
MDL Number: | MFCD06858709 |
SMILES: | OC(=O)c1cccc(c1)c1cc(cc(c1)C(F)(F)F)C(F)(F)F |
Complexity: | 409 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 5.5 |
Journal of medicinal chemistry 20050407