AX63598
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 1 week | $146.00 | $102.00 | - + | |
5mg | 95% | 1 week | $339.00 | $237.00 | - + | |
10mg | >99% by Achiral and Chiral HPLCs | 1 week | $442.00 | $309.00 | - + | |
25mg | 95% | 1 week | $781.00 | $547.00 | - + | |
50mg | 95% | 1 week | $1,089.00 | $762.00 | - + | |
100mg | 95% | 1 week | $1,433.00 | $1,003.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX63598 |
Chemical Name: | E-7386 |
CAS Number: | 1799824-08-0 |
Molecular Formula: | C39H48FN9O4 |
Molecular Weight: | 725.8547 |
MDL Number: | MFCD31619284 |
SMILES: | C=CCN1CC(=O)N2[C@@H](N1C(=O)NCc1ccccc1)CN(C(=O)[C@@H]2Cc1ccc(cc1F)O)Cc1cccc(n1)N1CC(C1)N1CCN(CC1)CC |