AA95787
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $9.00 | $6.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $26.00 | $18.00 | - + | |
100g | 98% | in stock | $90.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA95787 |
Chemical Name: | 4-Carboxyphenylboronic acid, pinacol ester |
CAS Number: | 180516-87-4 |
Molecular Formula: | C13H17BO4 |
Molecular Weight: | 248.0827 |
MDL Number: | MFCD01863710 |
SMILES: | OC(=O)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 316 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in the creation of various organic molecules through Suzuki-Miyaura cross-coupling reactions. By acting as a boronic acid derivative, $name$ participates in coupling reactions with aryl halides or pseudohalides, enabling the formation of complex structures with high efficiency. Additionally, $name$ is known for its stability and compatibility with a wide range of functional groups, making it a preferred reagent in the synthesis of pharmaceuticals, agrochemicals, and materials science.