AA96500
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 95% | 1 week | $358.00 | $250.00 | - + | |
1g | 95% | 1 week | $593.00 | $415.00 | - + | |
5g | 95% | 1 week | $2,131.00 | $1,492.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA96500 |
Chemical Name: | Phosphoric trichloride, reaction products with bisphenol A and phenol |
CAS Number: | 181028-79-5 |
Molecular Formula: | C15H20O9P2 |
Molecular Weight: | 406.2614 |
MDL Number: | MFCD09752835 |
SMILES: | CC(c1ccc(cc1)O)(c1ccc(cc1)O)C.OP(=O)(OP(=O)(O)O)O |