AA96695
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $8.00 | $6.00 | - + | |
1g | 97% | in stock | $10.00 | $7.00 | - + | |
5g | 97% | in stock | $16.00 | $11.00 | - + | |
10g | 97% | in stock | $20.00 | $14.00 | - + | |
25g | 97% | in stock | $47.00 | $33.00 | - + | |
100g | 97% | in stock | $187.00 | $131.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA96695 |
Chemical Name: | tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate |
CAS Number: | 181269-69-2 |
Molecular Formula: | C11H19NO3 |
Molecular Weight: | 213.2735 |
MDL Number: | MFCD08460962 |
SMILES: | O=C1CCN(CC1C)C(=O)OC(C)(C)C |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.1 |
The tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate is a versatile compound that finds wide application in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. Its unique chemical structure allows for selective modification, making it valuable in designing complex molecules with specific properties.In chemical synthesis, tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate is often used as a precursor for synthesizing biologically active compounds and drug candidates. It is employed in the construction of heterocyclic frameworks and serves as a starting point for the introduction of different functional groups. This compound's reactivity and stability make it a favored choice for creating diverse molecular structures with high efficiency.Furthermore, tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate plays a crucial role in the development of novel materials with tailored properties. By incorporating this compound into synthetic pathways, chemists can access a wide range of derivatives with varying solubility, stability, and bioactivity. Its presence in the synthesis of advanced materials showcases its significance in advancing diverse fields like medicine, agriculture, and materials science.