AY09988
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $87.00 | $61.00 | - + | |
10mg | 98% | in stock | $675.00 | $473.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY09988 |
Chemical Name: | BMS-1166 |
CAS Number: | 1818314-88-3 |
Molecular Formula: | C36H33ClN2O7 |
Molecular Weight: | 641.1094 |
MDL Number: | MFCD31746874 |
SMILES: | N#Cc1cccc(c1)COc1cc(OCc2cccc(c2C)c2ccc3c(c2)OCCO3)c(cc1CN1C[C@@H](C[C@@H]1C(=O)O)O)Cl |
BMS-1166 is a versatile compound that finds extensive application in chemical synthesis, particularly in organic chemistry. This compound serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique chemical properties make it a crucial ingredient in the production of advanced materials, fine chemicals, and intermediates for diverse industries. With its ability to undergo selective functional group transformations, BMS-1166 plays a pivotal role in the development of novel chemical entities and the modification of existing compounds. Chemists rely on BMS-1166 for its reactivity, efficiency, and reliability in carrying out complex synthesis routes, enabling the creation of innovative products with enhanced performance characteristics.