AD64927
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $24.00 | $17.00 | - + | |
1g | 95% | in stock | $53.00 | $37.00 | - + | |
5g | 95% | in stock | $148.00 | $103.00 | - + | |
10g | 95% | in stock | $259.00 | $182.00 | - + | |
25g | 95% | in stock | $519.00 | $363.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD64927 |
Chemical Name: | N-Benzoyl-5'-o-dmtr-2'-o-(2-methoxyethyl)-5-methyl cytidine |
CAS Number: | 182496-01-1 |
Molecular Formula: | C41H43N3O9 |
Molecular Weight: | 721.7948 |
MDL Number: | MFCD14586329 |
SMILES: | COCCO[C@@H]1[C@H](O)[C@H](O[C@H]1n1cc(C)c(nc1=O)NC(=O)c1ccccc1)COC(c1ccc(cc1)OC)(c1ccc(cc1)OC)c1ccccc1 |
Complexity: | 1220 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 53 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 15 |
XLogP3: | 4.6 |
The N-Benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-5-methylcytidine compound finds extensive application in chemical synthesis as a versatile intermediate for the construction of complex nucleoside analogs. By serving as a key building block, this compound enables the synthesis of novel nucleoside derivatives with enhanced properties, such as improved stability, altered pharmacokinetics, and enhanced bioactivity. Its strategic incorporation in synthetic pathways allows for the tailored design of bioactive molecules for various scientific research, pharmaceutical, and medicinal purposes.