AB76076
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $18.00 | - + | |
5g | 97% | in stock | $55.00 | $38.00 | - + | |
10g | 97% | in stock | $66.00 | $46.00 | - + | |
25g | 97% | in stock | $146.00 | $103.00 | - + | |
100g | 97% | in stock | $373.00 | $261.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB76076 |
Chemical Name: | Methyl 3-indoleglyoxylate |
CAS Number: | 18372-22-0 |
Molecular Formula: | C11H9NO3 |
Molecular Weight: | 203.1941 |
MDL Number: | MFCD00047173 |
SMILES: | COC(=O)C(=O)c1c[nH]c2c1cccc2 |
Complexity: | 277 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.5 |
Marine drugs 20091201
The Journal of organic chemistry 20010323