AX64662
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $48.00 | $34.00 | - + | |
5mg | 98% | in stock | $173.00 | $121.00 | - + | |
10mg | 98% | in stock | $321.00 | $225.00 | - + | |
25mg | 98% | in stock | $624.00 | $437.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX64662 |
Chemical Name: | 1-{[2-({2-[(7-chloroquinolin-4-yl)amino]ethyl}(methyl)amino)ethyl]amino}-4-methyl-9H-thioxanthen-9-one |
CAS Number: | 1859141-26-6 |
Molecular Formula: | C28H27ClN4OS |
Molecular Weight: | 503.0582 |
MDL Number: | MFCD31619252 |
SMILES: | CN(CCNc1ccnc2c1ccc(c2)Cl)CCNc1ccc(c2c1c(=O)c1c(s2)cccc1)C |
Complexity: | 712 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 7 |
Comparative biochemistry and physiology. A, Comparative physiology 19751201