AB54994
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $22.00 | $15.00 | - + | |
1g | 98% | in stock | $38.00 | $27.00 | - + | |
5g | 98% | in stock | $96.00 | $68.00 | - + | |
25g | 98% | in stock | $449.00 | $315.00 | - + | |
100g | 98% | in stock | $1,070.00 | $749.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54994 |
Chemical Name: | 3-Benzyloxyphenylacetic acid |
CAS Number: | 1860-58-8 |
Molecular Formula: | C15H14O3 |
Molecular Weight: | 242.2699 |
MDL Number: | MFCD02664806 |
SMILES: | OC(=O)Cc1cccc(c1)OCc1ccccc1 |
Complexity: | 259 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 3 |
The Journal of organic chemistry 20110819
Bioorganic & medicinal chemistry letters 20050701